From Wikipedia, the free encyclopedia
Imetit
|
| Names
|
| IUPAC name
2-(1H-imidazol-5-yl)ethyl carbamimidothioate
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10)  NKey: PEHSVUKQDJULKE-UHFFFAOYSA-N NInChI=1/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10) Key: PEHSVUKQDJULKE-UHFFFAOYAJ
|
C1=C(NC=N1)CCSC(=N)N S(C(=[N@H])N)CCc1cnc[nH]1
|
| Properties
|
|
|
C6H10N4S
|
| Molar mass
|
170.2354 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Chemical compound
Imetit is a histamine H3 receptor agonist.[1]
- ^ Garbarg, M; Arrang, JM; Rouleau, A; Ligneau, X; Tuong, MD; Schwartz, JC; Ganellin, CR (1992). "S-2-(4-imidazolyl)ethylisothiourea, a highly specific and potent histamine H3 receptor agonist". The Journal of Pharmacology and Experimental Therapeutics. 263 (1): 304–10. doi:10.1016/S0022-3565(25)10340-6. PMID 1383495.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | |
|---|
|
